CAS 55186-75-9 appears in our catalog under these names: 1-(Prop-1-en-2-yl)-4-(trifluoromethyl)benzene, 95+%, 1-Isopropenyl-4-trifluoromethyl-benzene. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 250mg, 1g.
1-prop-1-en-2-yl-4-(trifluoromethyl)benzene (CAS 55186-75-9) is a chemical compound with the molecular formula C10H9F3 and a molecular weight of 186.17 g/mol. IUPAC name: 1-prop-1-en-2-yl-4-(trifluoromethyl)benzene. InChIKey: JQIVSZSXUMTYJJ-UHFFFAOYSA-N.
| Molecular formula | C10H9F3 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | 1-prop-1-en-2-yl-4-(trifluoromethyl)benzene |
| InChIKey | JQIVSZSXUMTYJJ-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)