CAS 951892-93-6 is the registry number for 3-(3,4,5-Trifluorophenyl)-2-methyl-1-propene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3-trifluoro-5-(2-methylprop-2-enyl)benzene (CAS 951892-93-6) is a chemical compound with the molecular formula C10H9F3 and a molecular weight of 186.17 g/mol. IUPAC name: 1,2,3-trifluoro-5-(2-methylprop-2-enyl)benzene. InChIKey: HHVHIIYCLKNWRK-UHFFFAOYSA-N.
| Molecular formula | C10H9F3 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | 1,2,3-trifluoro-5-(2-methylprop-2-enyl)benzene |
| InChIKey | HHVHIIYCLKNWRK-UHFFFAOYSA-N |
| SMILES | CC(=C)CC1=CC(=C(C(=C1)F)F)F |
Computed by PubChem (NCBI)