CAS 55198-89-5 appears in our catalog under these names: 3-Amino-4-(2-chlorophenyl)-6-nitroquinolin-2(1h)-one, 95%, Clonazepam Impurity A(USP), Clonazepam Impurity 3, 3-Amino-4-(2-chlorophenyl)-6-nitro-2(1H)-quinolinone (Clonazepam Impurity), >95% (HPLC), 3-Amino-4-(2-chlorophenyl)-6-nitroquinolin-2(1H)-one. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 1g, 100mg, 5g, 250mg, on request, 10mg, 25mg, 50mg.
3-amino-4-(2-chlorophenyl)-6-nitro-1H-quinolin-2-one (CAS 55198-89-5) is a chemical compound with the molecular formula C15H10ClN3O3 and a molecular weight of 315.71 g/mol. IUPAC name: 3-amino-4-(2-chlorophenyl)-6-nitro-1H-quinolin-2-one. InChIKey: GYAWOVGCEQLWHW-UHFFFAOYSA-N.
| Molecular formula | C15H10ClN3O3 |
|---|---|
| Molecular weight | 315.71 g/mol |
| IUPAC name | 3-amino-4-(2-chlorophenyl)-6-nitro-1H-quinolin-2-one |
| InChIKey | GYAWOVGCEQLWHW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(C(=O)NC3=C2C=C(C=C3)[N+](=O)[O-])N)Cl |
Computed by PubChem (NCBI)