CAS 907200-06-0 is the registry number for Clonazepam-13C2 ,15N, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
5-(2-chlorophenyl)-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 907200-06-0) is a chemical compound with the molecular formula C15H10ClN3O3 and a molecular weight of 318.69 g/mol. IUPAC name: 5-(2-chlorophenyl)-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: DGBIGWXXNGSACT-XOWCGMJMSA-N.
| Molecular formula | C15H10ClN3O3 |
|---|---|
| Molecular weight | 318.69 g/mol |
| IUPAC name | 5-(2-chlorophenyl)-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | DGBIGWXXNGSACT-XOWCGMJMSA-N |
| SMILES | [13CH2]1[13C](=O)NC2=C(C=C(C=C2)[N+](=O)[O-])C(=[15N]1)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)