Products 55285-29-5
CAS 55285-29-5 appears in our catalog under these names: 2-[(2,5-Dimethylphenyl)amino]nicotinic acid, 95%, 2-((2,5-Dimethylphenyl)amino)nicotinic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(2,5-dimethylanilino)pyridine-3-carboxylic acid (CAS 55285-29-5) is a chemical compound with the molecular formula C14H14N2O2 and a molecular weight of 242.27 g/mol. IUPAC name: 2-(2,5-dimethylanilino)pyridine-3-carboxylic acid. InChIKey: JXROYZLSJSHPQI-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O2 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 2-(2,5-dimethylanilino)pyridine-3-carboxylic acid |
| InChIKey | JXROYZLSJSHPQI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)NC2=C(C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)