CAS 889676-34-0 appears in our catalog under these names: 1-BOC-6-cyanoindole, 98%, tert-Butyl 6-cyano-1H-indole-1-carboxylate, 98%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 100g.
Tert-butyl 6-cyanoindole-1-carboxylate (CAS 889676-34-0) is a chemical compound with the molecular formula C14H14N2O2 and a molecular weight of 242.27 g/mol. IUPAC name: tert-butyl 6-cyanoindole-1-carboxylate. InChIKey: DCIWEPSVBLICSS-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O2 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | tert-butyl 6-cyanoindole-1-carboxylate |
| InChIKey | DCIWEPSVBLICSS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C1C=C(C=C2)C#N |
Computed by PubChem (NCBI)