CAS 55326-78-8 is the registry number for Copper(II) L-tartrate hydrate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper;(2R,3R)-2,3-dihydroxybutanedioate;hydrate (CAS 55326-78-8) is a chemical compound with the molecular formula C4H6CuO7 and a molecular weight of 229.63 g/mol. IUPAC name: copper;(2R,3R)-2,3-dihydroxybutanedioate;hydrate. InChIKey: MAUZTCHAIPUZJB-OLXYHTOASA-L.
| Molecular formula | C4H6CuO7 |
|---|---|
| Molecular weight | 229.63 g/mol |
| IUPAC name | copper;(2R,3R)-2,3-dihydroxybutanedioate;hydrate |
| InChIKey | MAUZTCHAIPUZJB-OLXYHTOASA-L |
| SMILES | [C@@H]([C@H](C(=O)[O-])O)(C(=O)[O-])O.O.[Cu+2] |
Computed by PubChem (NCBI)