CAS 946843-80-7 appears in our catalog under these names: Copper(II) tartrate hydrate,99·90%, Copper(II) tartrate hydrate, Copper(II) tartrate hydrate, 98.00%, Copper(II) L-tartrate xhydrate 98%, Copper(II) tartrate hydrate, >= 95.0 % &. Offered by: GLPBio, Biosynth, Chemat, Ambeed, Sigma-Aldrich. Available pack sizes: 50g, 100g, 25g, 5g.
Copper;(2R,3R)-2,3-dihydroxybutanedioate;hydrate (CAS 946843-80-7) is a chemical compound with the molecular formula C4H6CuO7 and a molecular weight of 229.63 g/mol. IUPAC name: copper;(2R,3R)-2,3-dihydroxybutanedioate;hydrate. InChIKey: MAUZTCHAIPUZJB-OLXYHTOASA-L.
| Molecular formula | C4H6CuO7 |
|---|---|
| Molecular weight | 229.63 g/mol |
| IUPAC name | copper;(2R,3R)-2,3-dihydroxybutanedioate;hydrate |
| InChIKey | MAUZTCHAIPUZJB-OLXYHTOASA-L |
| SMILES | [C@@H]([C@H](C(=O)[O-])O)(C(=O)[O-])O.O.[Cu+2] |
Computed by PubChem (NCBI)