CAS 5540-31-8 is the registry number for Methyl 3,6-anhydro-a-D-galactopyranoside. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 100mg, 50mg, 1000mg.
(1R,3S,4R,5S,8S)-3-methoxy-2,6-dioxabicyclo[3.2.1]octane-4,8-diol (CAS 5540-31-8) is a chemical compound with the molecular formula C7H12O5 and a molecular weight of 176.17 g/mol. IUPAC name: (1R,3S,4R,5S,8S)-3-methoxy-2,6-dioxabicyclo[3.2.1]octane-4,8-diol. InChIKey: LYLSUYCOHWVOFS-UOYQFSTFSA-N.
| Molecular formula | C7H12O5 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | (1R,3S,4R,5S,8S)-3-methoxy-2,6-dioxabicyclo[3.2.1]octane-4,8-diol |
| InChIKey | LYLSUYCOHWVOFS-UOYQFSTFSA-N |
| SMILES | CO[C@@H]1[C@@H]([C@@H]2[C@H]([C@H](O1)CO2)O)O |
Computed by PubChem (NCBI)