CAS 55435-56-8 appears in our catalog under these names: (2-[(E)-2-Phenylvinyl]-4,5-dihydro-1,3-oxazole-4,4-diyl)dimethanol, 95%, (2-((E)-2-PHenylvinyl)-4,5-dihydro-1,3-oxazole-4,4-diyl)dimethanol, 95% mix TBC as stabilizer. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
[4-(hydroxymethyl)-2-[(E)-2-phenylethenyl]-5H-1,3-oxazol-4-yl]methanol (CAS 55435-56-8) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: [4-(hydroxymethyl)-2-[(E)-2-phenylethenyl]-5H-1,3-oxazol-4-yl]methanol. InChIKey: ZJOCDHLLTLVNKW-VOTSOKGWSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | [4-(hydroxymethyl)-2-[(E)-2-phenylethenyl]-5H-1,3-oxazol-4-yl]methanol |
| InChIKey | ZJOCDHLLTLVNKW-VOTSOKGWSA-N |
| SMILES | C1C(N=C(O1)/C=C/C2=CC=CC=C2)(CO)CO |
Computed by PubChem (NCBI)