CAS 55441-25-3 appears in our catalog under these names: N-(2-Cyanophenyl)urea, 95%, 1-(2-Cyanophenyl)urea, 95+%, (2-Cyanophenyl)urea. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
(2-cyanophenyl)urea (CAS 55441-25-3) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: (2-cyanophenyl)urea. InChIKey: QUAYEHVOVRZTOO-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | (2-cyanophenyl)urea |
| InChIKey | QUAYEHVOVRZTOO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)NC(=O)N |
Computed by PubChem (NCBI)