CAS 554425-48-8 appears in our catalog under these names: 3-Hydroxy-3h-benzotriazole-5-sulfonic acid dimethylamide, 95%, 1-Hydroxy-N,N-dimethyl-1H-1,2,3-benzotriazole-6-sulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
3-hydroxy-N,N-dimethylbenzotriazole-5-sulfonamide (CAS 554425-48-8) is a chemical compound with the molecular formula C8H10N4O3S and a molecular weight of 242.26 g/mol. IUPAC name: 3-hydroxy-N,N-dimethylbenzotriazole-5-sulfonamide. InChIKey: MMTNAHRIPAKUCD-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O3S |
|---|---|
| Molecular weight | 242.26 g/mol |
| IUPAC name | 3-hydroxy-N,N-dimethylbenzotriazole-5-sulfonamide |
| InChIKey | MMTNAHRIPAKUCD-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC2=C(C=C1)N=NN2O |
Computed by PubChem (NCBI)