Products 89051-57-0
CAS 89051-57-0 appears in our catalog under these names: Tazobactam Impurity W, Tazobactam Impurity 20. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S,3S,5R)-3-(azidomethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS 89051-57-0) is a chemical compound with the molecular formula C8H10N4O3S and a molecular weight of 242.26 g/mol. IUPAC name: (2S,3S,5R)-3-(azidomethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid. InChIKey: GFMBCIODNTYSHS-CHKWXVPMSA-N.
| Molecular formula | C8H10N4O3S |
|---|---|
| Molecular weight | 242.26 g/mol |
| IUPAC name | (2S,3S,5R)-3-(azidomethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChIKey | GFMBCIODNTYSHS-CHKWXVPMSA-N |
| SMILES | C[C@@]1([C@@H](N2[C@H](S1)CC2=O)C(=O)O)CN=[N+]=[N-] |
Computed by PubChem (NCBI)
Synonyms:
Tazobactam Impurity W