CAS 55486-27-6 appears in our catalog under these names: 3-Phenyl-1-(piperazin-1-yl)prop-2-en-1-one, 97%, 1-Cinnamoylpiperazine, 96%, 96%, 1-Cinnamoylpiperazine, 96%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 2g, 250mg.
(E)-3-phenyl-1-piperazin-1-ylprop-2-en-1-one (CAS 55486-27-6) is a chemical compound with the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. IUPAC name: (E)-3-phenyl-1-piperazin-1-ylprop-2-en-1-one. InChIKey: DLCYXQODDJUHQL-VOTSOKGWSA-N.
| Molecular formula | C13H16N2O |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | (E)-3-phenyl-1-piperazin-1-ylprop-2-en-1-one |
| InChIKey | DLCYXQODDJUHQL-VOTSOKGWSA-N |
| SMILES | C1CN(CCN1)C(=O)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)