CAS 55677-61-7 is the registry number for (2S)-2-Amino-N-(2-phenylethyl)propanamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(2S)-2-amino-N-(2-phenylethyl)propanamide (CAS 55677-61-7) is a chemical compound with the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. IUPAC name: (2S)-2-amino-N-(2-phenylethyl)propanamide. InChIKey: NEXKSALWCGMYJO-VIFPVBQESA-N.
| Molecular formula | C11H16N2O |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | (2S)-2-amino-N-(2-phenylethyl)propanamide |
| InChIKey | NEXKSALWCGMYJO-VIFPVBQESA-N |
| SMILES | C[C@@H](C(=O)NCCC1=CC=CC=C1)N |
Computed by PubChem (NCBI)