CAS 556801-09-3 appears in our catalog under these names: Linezolid Impurity 91, (R)-(3-(4-Morpholinophenyl)-2-oxooxazolidin-5-yl)methyl methanesulfonate, 95%. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
[(5R)-3-(4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate (CAS 556801-09-3) is a chemical compound with the molecular formula C15H20N2O6S and a molecular weight of 356.4 g/mol. IUPAC name: [(5R)-3-(4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate. InChIKey: IXNNXBOJAFWIEL-CQSZACIVSA-N.
| Molecular formula | C15H20N2O6S |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | [(5R)-3-(4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
| InChIKey | IXNNXBOJAFWIEL-CQSZACIVSA-N |
| SMILES | CS(=O)(=O)OC[C@H]1CN(C(=O)O1)C2=CC=C(C=C2)N3CCOCC3 |
Computed by PubChem (NCBI)