Products 796106-55-3

CAS 796106-55-3 is the registry number for 2-Morpholin-4-yl-5-(morpholin-4-ylsulfonyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-morpholin-4-yl-5-morpholin-4-ylsulfonylbenzoic acid (CAS 796106-55-3) is a chemical compound with the molecular formula C15H20N2O6S and a molecular weight of 356.4 g/mol. IUPAC name: 2-morpholin-4-yl-5-morpholin-4-ylsulfonylbenzoic acid. InChIKey: PDGGGTAUHVTAJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20N2O6S
Molecular weight356.4 g/mol
IUPAC name2-morpholin-4-yl-5-morpholin-4-ylsulfonylbenzoic acid
InChIKeyPDGGGTAUHVTAJJ-UHFFFAOYSA-N
SMILESC1COCCN1C2=C(C=C(C=C2)S(=O)(=O)N3CCOCC3)C(=O)O

Computed by PubChem (NCBI)