CAS 55738-70-0 is the registry number for 5-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)benzene-1,3-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(2,5-dioxopyrrol-1-yl)benzene-1,3-dicarboxylic acid (CAS 55738-70-0) is a chemical compound with the molecular formula C12H7NO6 and a molecular weight of 261.19 g/mol. IUPAC name: 5-(2,5-dioxopyrrol-1-yl)benzene-1,3-dicarboxylic acid. InChIKey: CHTJKKKLRNPKNB-UHFFFAOYSA-N.
| Molecular formula | C12H7NO6 |
|---|---|
| Molecular weight | 261.19 g/mol |
| IUPAC name | 5-(2,5-dioxopyrrol-1-yl)benzene-1,3-dicarboxylic acid |
| InChIKey | CHTJKKKLRNPKNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)C2=CC(=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)