CAS 56896-91-4 appears in our catalog under these names: 4-(2,5-Dioxo-2,5-dihydropyrrol-1-yl)phthalic acid, 98%, 4-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)phthalic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
4-(2,5-dioxopyrrol-1-yl)phthalic acid (CAS 56896-91-4) is a chemical compound with the molecular formula C12H7NO6 and a molecular weight of 261.19 g/mol. IUPAC name: 4-(2,5-dioxopyrrol-1-yl)phthalic acid. InChIKey: TVCWROCCGJJZDF-UHFFFAOYSA-N.
| Molecular formula | C12H7NO6 |
|---|---|
| Molecular weight | 261.19 g/mol |
| IUPAC name | 4-(2,5-dioxopyrrol-1-yl)phthalic acid |
| InChIKey | TVCWROCCGJJZDF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C(=O)C=CC2=O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)