CAS 5577-13-9 appears in our catalog under these names: Gliclazide EP Impurity C, Ethyl ((4-Methylphenyl)sulphonyl)carbamate, Tosylurethane, >95% (HPLC), Ethyl tosylcarbamate, Ethyl tosylcarbamate 95%. Offered by: Chemat Brand, Mikromol, TRC, TargetMol, Ambeed. Available pack sizes: on request, 25mg, 100mg, 10g, 1g, 5mg, 100g, 250mg.
Ethyl N-(4-methylphenyl)sulfonylcarbamate (CAS 5577-13-9) is a chemical compound with the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. IUPAC name: ethyl N-(4-methylphenyl)sulfonylcarbamate. InChIKey: DFWQXANLGSXMKF-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | ethyl N-(4-methylphenyl)sulfonylcarbamate |
| InChIKey | DFWQXANLGSXMKF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NS(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)