Products 55855-45-3

CAS 55855-45-3 is the registry number for N-Nitroso Atropine EP Impurity B. Offered by: Chemat Brand. Available pack sizes: on request.

(8-nitroso-8-azabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate (CAS 55855-45-3) is a chemical compound with the molecular formula C16H20N2O4 and a molecular weight of 304.34 g/mol. IUPAC name: (8-nitroso-8-azabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate. InChIKey: MGNXWIFTCSNJDB-UHFFFAOYSA-N.

Identity
Molecular formulaC16H20N2O4
Molecular weight304.34 g/mol
IUPAC name(8-nitroso-8-azabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate
InChIKeyMGNXWIFTCSNJDB-UHFFFAOYSA-N
SMILESC1CC2CC(CC1N2N=O)OC(=O)C(CO)C3=CC=CC=C3

Computed by PubChem (NCBI)