Products 55889-34-4
CAS 55889-34-4 is the registry number for 1-(1H-Benzo(d)(1,2,3)triazol-1-yl)-3,3-dimethylbutan-1-one, 97%. Offered by: AmBeed. Available pack sizes: 50mg.
1-(benzotriazol-1-yl)-3,3-dimethylbutan-1-one (CAS 55889-34-4) is a chemical compound with the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. IUPAC name: 1-(benzotriazol-1-yl)-3,3-dimethylbutan-1-one. InChIKey: ZGYTUDOKBYAGMV-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O |
|---|---|
| Molecular weight | 217.27 g/mol |
| IUPAC name | 1-(benzotriazol-1-yl)-3,3-dimethylbutan-1-one |
| InChIKey | ZGYTUDOKBYAGMV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(=O)N1C2=CC=CC=C2N=N1 |
Computed by PubChem (NCBI)