CAS 55902-93-7 is the registry number for Mebenoside, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4R,5R)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-2-methoxy-4-phenylmethoxyoxolan-3-ol (CAS 55902-93-7) is a chemical compound with the molecular formula C28H32O6 and a molecular weight of 464.5 g/mol. IUPAC name: (3R,4R,5R)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-2-methoxy-4-phenylmethoxyoxolan-3-ol. InChIKey: MYVXMYUGQJQBIV-OYDXEKDZSA-N.
| Molecular formula | C28H32O6 |
|---|---|
| Molecular weight | 464.5 g/mol |
| IUPAC name | (3R,4R,5R)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-2-methoxy-4-phenylmethoxyoxolan-3-ol |
| InChIKey | MYVXMYUGQJQBIV-OYDXEKDZSA-N |
| SMILES | COC1[C@@H]([C@H]([C@H](O1)[C@@H](COCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4)O |
Computed by PubChem (NCBI)