Products 906794-56-7
CAS 906794-56-7 appears in our catalog under these names: Parvifolixanthone A, Parvifolixanthone A. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
1,3,5,6-tetrahydroxy-2,4,7-tris(3-methylbut-2-enyl)xanthen-9-one (CAS 906794-56-7) is a chemical compound with the molecular formula C28H32O6 and a molecular weight of 464.5 g/mol. IUPAC name: 1,3,5,6-tetrahydroxy-2,4,7-tris(3-methylbut-2-enyl)xanthen-9-one. InChIKey: UVAAZIOBAWMBHC-UHFFFAOYSA-N.
| Molecular formula | C28H32O6 |
|---|---|
| Molecular weight | 464.5 g/mol |
| IUPAC name | 1,3,5,6-tetrahydroxy-2,4,7-tris(3-methylbut-2-enyl)xanthen-9-one |
| InChIKey | UVAAZIOBAWMBHC-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=CC2=C(C(=C1O)O)OC3=C(C(=C(C(=C3C2=O)O)CC=C(C)C)O)CC=C(C)C)C |
Computed by PubChem (NCBI)