Products 55934-03-7
CAS 55934-03-7 is the registry number for 6-Amino-3,4,5-trichloropicolinic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-amino-3,4,5-trichloropyridine-2-carboxylic acid (CAS 55934-03-7) is a chemical compound with the molecular formula C6H3Cl3N2O2 and a molecular weight of 241.5 g/mol. IUPAC name: 6-amino-3,4,5-trichloropyridine-2-carboxylic acid. InChIKey: ATHJTJOXOQJKEC-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl3N2O2 |
|---|---|
| Molecular weight | 241.5 g/mol |
| IUPAC name | 6-amino-3,4,5-trichloropyridine-2-carboxylic acid |
| InChIKey | ATHJTJOXOQJKEC-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=NC(=C1Cl)N)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)