CAS 87846-94-4 is the registry number for Methyl 2,4,6-trichloropyrimidine-5-carboxylate, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Methyl 2,4,6-trichloropyrimidine-5-carboxylate (CAS 87846-94-4) is a chemical compound with the molecular formula C6H3Cl3N2O2 and a molecular weight of 241.5 g/mol. IUPAC name: methyl 2,4,6-trichloropyrimidine-5-carboxylate. InChIKey: QQYFJQHMJIBLKL-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl3N2O2 |
|---|---|
| Molecular weight | 241.5 g/mol |
| IUPAC name | methyl 2,4,6-trichloropyrimidine-5-carboxylate |
| InChIKey | QQYFJQHMJIBLKL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=C(N=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)