CAS 5596-07-6 is the registry number for Phenylephrine EP Impurity A. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(1R)-2-amino-1-hydroxyethyl]phenol (CAS 5596-07-6) is a chemical compound with the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. IUPAC name: 3-[(1R)-2-amino-1-hydroxyethyl]phenol. InChIKey: LRCXRAABFLIVAI-QMMMGPOBSA-N.
| Molecular formula | C8H11NO2 |
|---|---|
| Molecular weight | 153.18 g/mol |
| IUPAC name | 3-[(1R)-2-amino-1-hydroxyethyl]phenol |
| InChIKey | LRCXRAABFLIVAI-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC(=C1)O)[C@H](CN)O |
Computed by PubChem (NCBI)