CAS 56-37-1 appears in our catalog under these names: Benzyltriethylammonium Chloride, Benzyltriethylammonium chloride, 99% , Benzyltriethylammonium chloride, 98%, Benzyltriethylammonium Chloride, >98.0%(HPLC)(T), Benzyltriethylammonium chloride 97%. Offered by: TRC, Chemat, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros). Available pack sizes: 100g, 10g, 25g, 250g, 500g, 0,5kg, 1kg, 2.5KG.
Benzyl(triethyl)azanium chloride (CAS 56-37-1) is a chemical compound with the molecular formula C13H22ClN and a molecular weight of 227.77 g/mol. IUPAC name: benzyl(triethyl)azanium chloride. InChIKey: HTZCNXWZYVXIMZ-UHFFFAOYSA-M.
| Molecular formula | C13H22ClN |
|---|---|
| Molecular weight | 227.77 g/mol |
| IUPAC name | benzyl(triethyl)azanium chloride |
| InChIKey | HTZCNXWZYVXIMZ-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)CC1=CC=CC=C1.[Cl-] |
Computed by PubChem (NCBI)