CAS 56022-26-5 appears in our catalog under these names: 2-Thioxo-2,3-dihydro-4h-1,3-benzothiazin-4-one, 95%, 2-Thioxo-2H-benzo(e)(1,3)thiazin-4(3H)-one, 97%, 2-Thioxo-2H-benzo[e][1,3]thiazin-4(3H)-one 95%, 2-THIOXO-2H-BENZO[E][1,3]THIAZIN-4(3H)-ONE, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 50mg, 100mg.
2-sulfanylidene-1,3-benzothiazin-4-one (CAS 56022-26-5) is a chemical compound with the molecular formula C8H5NOS2 and a molecular weight of 195.3 g/mol. IUPAC name: 2-sulfanylidene-1,3-benzothiazin-4-one. InChIKey: OLKPPPPATKQSBL-UHFFFAOYSA-N.
| Molecular formula | C8H5NOS2 |
|---|---|
| Molecular weight | 195.3 g/mol |
| IUPAC name | 2-sulfanylidene-1,3-benzothiazin-4-one |
| InChIKey | OLKPPPPATKQSBL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=S)S2 |
Computed by PubChem (NCBI)