CAS 7047-10-1 appears in our catalog under these names: Phenyl-3H-1,2,4-dithiazol-3-one, Phenyl-3H-1,2,4-dithiazol-3-one, 95%, 95%, Phenyl-3H-1,2,4-dithiazol-3-one, min. 95 %, 5 g, Phenyl-3H-1,2,4-dithiazol-3-one, min. 95 %, 10 g, Phenyl-3H-1,2,4-dithiazol-3-one, min. 95 %, 25 g. Offered by: Biosynth, Chemat, Roth. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 100mg, 250mg, 1g.
5-phenyl-1,2,4-dithiazol-3-one (CAS 7047-10-1) is a chemical compound with the molecular formula C8H5NOS2 and a molecular weight of 195.3 g/mol. IUPAC name: 5-phenyl-1,2,4-dithiazol-3-one. InChIKey: LKDWQHQNDDNHSC-UHFFFAOYSA-N.
| Molecular formula | C8H5NOS2 |
|---|---|
| Molecular weight | 195.3 g/mol |
| IUPAC name | 5-phenyl-1,2,4-dithiazol-3-one |
| InChIKey | LKDWQHQNDDNHSC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=O)SS2 |
Computed by PubChem (NCBI)