CAS 56041-75-9 is the registry number for 1-(4-Bromophenyl)-1-cyclopropylethanol, 97%. Offered by: AmBeed. Available pack sizes: 5g.
1-(4-bromophenyl)-1-cyclopropylethanol (CAS 56041-75-9) is a chemical compound with the molecular formula C11H13BrO and a molecular weight of 241.12 g/mol. IUPAC name: 1-(4-bromophenyl)-1-cyclopropylethanol. InChIKey: AKWHXCFLUPFEEX-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | 1-(4-bromophenyl)-1-cyclopropylethanol |
| InChIKey | AKWHXCFLUPFEEX-UHFFFAOYSA-N |
| SMILES | CC(C1CC1)(C2=CC=C(C=C2)Br)O |
Computed by PubChem (NCBI)