CAS 561067-98-9 is the registry number for Tideglusib. Offered by: TRC. Available pack sizes: 100mg, 1g.
2,5-bis(2,6-dimethylanilino)cyclohexa-2,5-diene-1,4-dione (CAS 561067-98-9) is a chemical compound with the molecular formula C22H22N2O2 and a molecular weight of 346.4 g/mol. IUPAC name: 2,5-bis(2,6-dimethylanilino)cyclohexa-2,5-diene-1,4-dione. InChIKey: IGHJFYOMBDCKTH-UHFFFAOYSA-N.
| Molecular formula | C22H22N2O2 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 2,5-bis(2,6-dimethylanilino)cyclohexa-2,5-diene-1,4-dione |
| InChIKey | IGHJFYOMBDCKTH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC2=CC(=O)C(=CC2=O)NC3=C(C=CC=C3C)C |
Computed by PubChem (NCBI)