Products 5613-24-1

CAS 5613-24-1 is the registry number for 6-Chloro-2,3-dimethylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

6-chloro-2,3-dimethylbenzoic acid (CAS 5613-24-1) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: 6-chloro-2,3-dimethylbenzoic acid. InChIKey: UFNGKBNVEUVMPQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClO2
Molecular weight184.62 g/mol
IUPAC name6-chloro-2,3-dimethylbenzoic acid
InChIKeyUFNGKBNVEUVMPQ-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)Cl)C(=O)O)C

Computed by PubChem (NCBI)