CAS 5613-24-1 is the registry number for 6-Chloro-2,3-dimethylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-chloro-2,3-dimethylbenzoic acid (CAS 5613-24-1) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: 6-chloro-2,3-dimethylbenzoic acid. InChIKey: UFNGKBNVEUVMPQ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 6-chloro-2,3-dimethylbenzoic acid |
| InChIKey | UFNGKBNVEUVMPQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Cl)C(=O)O)C |
Computed by PubChem (NCBI)