CAS 938-67-0 appears in our catalog under these names: 1-(3-Chloro-2-hydroxyphenyl)propan-1-one, 95%, 1-(3-chloro-2-hydroxyphenyl)propan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 5g, 100mg.
1-(3-chloro-2-hydroxyphenyl)propan-1-one (CAS 938-67-0) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: 1-(3-chloro-2-hydroxyphenyl)propan-1-one. InChIKey: GMFWHBJASTVOFN-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 1-(3-chloro-2-hydroxyphenyl)propan-1-one |
| InChIKey | GMFWHBJASTVOFN-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C(=CC=C1)Cl)O |
Computed by PubChem (NCBI)