Products 561305-83-7
CAS 561305-83-7 is the registry number for 2-(4-Bromophenyl)-3-oxo-3-(thiophen-2-yl)propanenitrile. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(4-bromophenyl)-3-oxo-3-thiophen-2-ylpropanenitrile (CAS 561305-83-7) is a chemical compound with the molecular formula C13H8BrNOS and a molecular weight of 306.18 g/mol. IUPAC name: 2-(4-bromophenyl)-3-oxo-3-thiophen-2-ylpropanenitrile. InChIKey: HQTUQNVFGUYRQA-UHFFFAOYSA-N.
| Molecular formula | C13H8BrNOS |
|---|---|
| Molecular weight | 306.18 g/mol |
| IUPAC name | 2-(4-bromophenyl)-3-oxo-3-thiophen-2-ylpropanenitrile |
| InChIKey | HQTUQNVFGUYRQA-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)C(C#N)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)