Products 56154-58-6
CAS 56154-58-6 appears in our catalog under these names: 5-(1-(4-(Benzo(d)isothiazol-3-yl)piperazin-1-yl)-2-hydroxyethyl)-6-chloroindolin-2-one, Cannabifuran. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 5mg, 5 mg, 1 mg.
6-methyl-3-pentyl-9-propan-2-yldibenzofuran-1-ol (CAS 56154-58-6) is a chemical compound with the molecular formula C21H26O2 and a molecular weight of 310.4 g/mol. IUPAC name: 6-methyl-3-pentyl-9-propan-2-yldibenzofuran-1-ol. InChIKey: VNGQMWZHHNCMLQ-UHFFFAOYSA-N.
| Molecular formula | C21H26O2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 6-methyl-3-pentyl-9-propan-2-yldibenzofuran-1-ol |
| InChIKey | VNGQMWZHHNCMLQ-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC(=C2C(=C1)OC3=C(C=CC(=C23)C(C)C)C)O |
Computed by PubChem (NCBI)