CAS 5617-70-9 appears in our catalog under these names: 6,6-Dimethyl-5,7-dioxaspiro(2.5)octan-4,8-dione, 6,6–Dimethyl–5,7–dioxaspiro(2·5)octane–4,8–dione, 6,6-Dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione, >98.0%(GC), 6,6-Dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione 98%, CYCLIC ISOPROPYLIDENE 1,1-CYCLOPROPANED&. Offered by: Chemat Brand, TRC, GLPBio, TCI, Ambeed. Available pack sizes: on request, 10g, 25g, 5g, 1g, 100g, 250mg, 500g.
6,6-dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione (CAS 5617-70-9) is a chemical compound with the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. IUPAC name: 6,6-dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione. InChIKey: AXJVPXNVESYGDT-UHFFFAOYSA-N.
| Molecular formula | C8H10O4 |
|---|---|
| Molecular weight | 170.16 g/mol |
| IUPAC name | 6,6-dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione |
| InChIKey | AXJVPXNVESYGDT-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C2(CC2)C(=O)O1)C |
Computed by PubChem (NCBI)