Products 56211-74-6
CAS 56211-74-6 is the registry number for 1,1,1-Trichloro-3-(quinolin-2-yl)propan-2-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,1,1-trichloro-3-quinolin-2-ylpropan-2-ol (CAS 56211-74-6) is a chemical compound with the molecular formula C12H10Cl3NO and a molecular weight of 290.6 g/mol. IUPAC name: 1,1,1-trichloro-3-quinolin-2-ylpropan-2-ol. InChIKey: NZHSXBNFZVWFFB-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl3NO |
|---|---|
| Molecular weight | 290.6 g/mol |
| IUPAC name | 1,1,1-trichloro-3-quinolin-2-ylpropan-2-ol |
| InChIKey | NZHSXBNFZVWFFB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)CC(C(Cl)(Cl)Cl)O |
Computed by PubChem (NCBI)