CAS 72782-76-4 is the registry number for 4-(2,4-Dichlorophenoxy)aniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2,4-dichlorophenoxy)aniline;hydrochloride (CAS 72782-76-4) is a chemical compound with the molecular formula C12H10Cl3NO and a molecular weight of 290.6 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)aniline;hydrochloride. InChIKey: VPOKWNPEXKYIPO-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl3NO |
|---|---|
| Molecular weight | 290.6 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)aniline;hydrochloride |
| InChIKey | VPOKWNPEXKYIPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)OC2=C(C=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)