CAS 5624-83-9 is the registry number for N-(2-Benzoyl-4-chlorophenyl)-2-(hydroxyamino)acetamide, 97%. Offered by: AmBeed. Available pack sizes: 5g.
N-(2-benzoyl-4-chlorophenyl)-2-(hydroxyamino)acetamide (CAS 5624-83-9) is a chemical compound with the molecular formula C15H13ClN2O3 and a molecular weight of 304.73 g/mol. IUPAC name: N-(2-benzoyl-4-chlorophenyl)-2-(hydroxyamino)acetamide. InChIKey: OCPNKQJUOLXBOE-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O3 |
|---|---|
| Molecular weight | 304.73 g/mol |
| IUPAC name | N-(2-benzoyl-4-chlorophenyl)-2-(hydroxyamino)acetamide |
| InChIKey | OCPNKQJUOLXBOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Cl)NC(=O)CNO |
Computed by PubChem (NCBI)