CAS 931259-50-6 is the registry number for 2-[(4-Chlorophenyl)amino]-2-oxoethyl 4-aminobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[2-(4-chloroanilino)-2-oxoethyl] 4-aminobenzoate (CAS 931259-50-6) is a chemical compound with the molecular formula C15H13ClN2O3 and a molecular weight of 304.73 g/mol. IUPAC name: [2-(4-chloroanilino)-2-oxoethyl] 4-aminobenzoate. InChIKey: XZDPYDMEWPVEPF-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O3 |
|---|---|
| Molecular weight | 304.73 g/mol |
| IUPAC name | [2-(4-chloroanilino)-2-oxoethyl] 4-aminobenzoate |
| InChIKey | XZDPYDMEWPVEPF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)OCC(=O)NC2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)