CAS 56271-94-4 appears in our catalog under these names: Cefuroxime Impurity 4(Cefuroxime Sodium EP Impurity A), Cefuroxime Sodium EP Impurity A, Cefuroxime EP Impurity A (Descarbamoyl Cefuroxime), Descarbamoyl Cefuroxime, >95% (HPLC), 3–hydroxy methyl Cefuroxime. Offered by: Hubei YoungXin, Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 5mg, 250mg.
(6R,7R)-7-[[(2Z)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 56271-94-4) is a chemical compound with the molecular formula C15H15N3O7S and a molecular weight of 381.4 g/mol. IUPAC name: (6R,7R)-7-[[(2Z)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: OUSLHGWWWMRAIG-FBCAJUAOSA-N.
| Molecular formula | C15H15N3O7S |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | (6R,7R)-7-[[(2Z)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | OUSLHGWWWMRAIG-FBCAJUAOSA-N |
| SMILES | CO/N=C(/C1=CC=CO1)\C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)CO)C(=O)O |
Computed by PubChem (NCBI)