CAS 97170-19-9 appears in our catalog under these names: Cefuroxime Sodium EP Impurity F, Cefuroxime EP Impurity F, Cefuroxime Impurity 6(Cefuroxime Sodium EP Impurity F). Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(6R,7R)-7-[[(2E)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 97170-19-9) is a chemical compound with the molecular formula C15H15N3O7S and a molecular weight of 381.4 g/mol. IUPAC name: (6R,7R)-7-[[(2E)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: OUSLHGWWWMRAIG-OGAOBHAHSA-N.
| Molecular formula | C15H15N3O7S |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | (6R,7R)-7-[[(2E)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | OUSLHGWWWMRAIG-OGAOBHAHSA-N |
| SMILES | CO/N=C(\C1=CC=CO1)/C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)CO)C(=O)O |
Computed by PubChem (NCBI)