Products 5628-49-9

CAS 5628-49-9 is the registry number for Methyl 6-amino-2,3-dimethylbenzoate, 95%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-[(2-methylphenyl)methyl]butanedioic acid (CAS 5628-49-9) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 2-[(2-methylphenyl)methyl]butanedioic acid. InChIKey: WFWVINOHIVDSEV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O4
Molecular weight222.24 g/mol
IUPAC name2-[(2-methylphenyl)methyl]butanedioic acid
InChIKeyWFWVINOHIVDSEV-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1CC(CC(=O)O)C(=O)O

Computed by PubChem (NCBI)