CAS 5628-67-1 appears in our catalog under these names: Methyl 4-chloro-2,3-dimethylbenzoate, 95%, Methyl 4-Chloro-2,3-dimethylbenzoate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
Methyl 4-chloro-2,3-dimethylbenzoate (CAS 5628-67-1) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: methyl 4-chloro-2,3-dimethylbenzoate. InChIKey: WPWWNWHMDILYHD-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | methyl 4-chloro-2,3-dimethylbenzoate |
| InChIKey | WPWWNWHMDILYHD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C)Cl)C(=O)OC |
Computed by PubChem (NCBI)