CAS 5634-34-4 is the registry number for Ambuphylline. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-amino-2-methylpropan-1-ol;1,3-dimethyl-7H-purine-2,6-dione (CAS 5634-34-4) is a chemical compound with the molecular formula C11H19N5O3 and a molecular weight of 269.30 g/mol. IUPAC name: 2-amino-2-methylpropan-1-ol;1,3-dimethyl-7H-purine-2,6-dione. InChIKey: SEIRRUDMPNNSCY-UHFFFAOYSA-N.
| Molecular formula | C11H19N5O3 |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | 2-amino-2-methylpropan-1-ol;1,3-dimethyl-7H-purine-2,6-dione |
| InChIKey | SEIRRUDMPNNSCY-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)N.CN1C2=C(C(=O)N(C1=O)C)NC=N2 |
Computed by PubChem (NCBI)