CAS 56469-26-2 appears in our catalog under these names: (±)–9–nor–9α–hydroxy Hexahydrocannabinol, (±)-9-Nor-9α-hydroxy Hexahydrocannabinol. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg, 500 μg.
(6aR,9S,10aR)-6,6-dimethyl-3-pentyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene-1,9-diol (CAS 56469-26-2) is a chemical compound with the molecular formula C20H30O3 and a molecular weight of 318.4 g/mol. IUPAC name: (6aR,9S,10aR)-6,6-dimethyl-3-pentyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene-1,9-diol. InChIKey: AAIHVZNCFQTVCA-ARFHVFGLSA-N.
| Molecular formula | C20H30O3 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | (6aR,9S,10aR)-6,6-dimethyl-3-pentyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene-1,9-diol |
| InChIKey | AAIHVZNCFQTVCA-ARFHVFGLSA-N |
| SMILES | CCCCCC1=CC(=C2[C@@H]3C[C@H](CC[C@H]3C(OC2=C1)(C)C)O)O |
Computed by PubChem (NCBI)