CAS 5651-77-4 is the registry number for 5-tert-Butyl-2-nitrophenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
5-tert-butyl-2-nitrophenol (CAS 5651-77-4) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 5-tert-butyl-2-nitrophenol. InChIKey: FQVUUPPMBGPBRL-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 5-tert-butyl-2-nitrophenol |
| InChIKey | FQVUUPPMBGPBRL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)