CAS 565193-46-6 appears in our catalog under these names: 4-Oxo-3-(propan-2-yl)-3,4-dihydrophthalazine-1-carbohydrazide, 95%, 3-Isopropyl-4-oxo-3,4-dihydrophthalazine-1-carbohydrazide, 98%, 4-Oxo-3-(propan-2-yl)-3,4-dihydrophthalazine-1-carbohydrazide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-oxo-3-propan-2-ylphthalazine-1-carbohydrazide (CAS 565193-46-6) is a chemical compound with the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. IUPAC name: 4-oxo-3-propan-2-ylphthalazine-1-carbohydrazide. InChIKey: UFKUJLNGUGAQQL-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O2 |
|---|---|
| Molecular weight | 246.27 g/mol |
| IUPAC name | 4-oxo-3-propan-2-ylphthalazine-1-carbohydrazide |
| InChIKey | UFKUJLNGUGAQQL-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)C2=CC=CC=C2C(=N1)C(=O)NN |
Computed by PubChem (NCBI)