CAS 79878-27-6 is the registry number for 1-Ethyl-7-methyl-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carbohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carbohydrazide (CAS 79878-27-6) is a chemical compound with the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. IUPAC name: 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carbohydrazide. InChIKey: LTXFNOZRVDFIKB-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O2 |
|---|---|
| Molecular weight | 246.27 g/mol |
| IUPAC name | 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carbohydrazide |
| InChIKey | LTXFNOZRVDFIKB-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=C1N=C(C=C2)C)C(=O)NN |
Computed by PubChem (NCBI)